C16H12O4 — CID 67340699
1-(2-hydroxyethoxy)anthracene-9,10-dione (PubChem CID 67340699) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)anthracene-9,10-dione.
| Compound Name | 1-(2-hydroxyethoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 67340699 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(2-hydroxyethoxy)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(OCCO)cccc21 |
| InChI | InChI=1S/C16H12O4/c17-8-9-20-13-7-3-6-12-14(13)16(19)11-5-2-1-4-10(11)15(12)18/h1-7,17H,8-9H2 |
| InChIKey | BFWCLDAHORZQDR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|