C17H14O5 — CID 90269328
1-(2-hydroxyethoxy)-5-methoxyanthracene-9,10-dione (PubChem CID 90269328) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)-5-methoxyanthracene-9,10-dione.
| Compound Name | 1-(2-hydroxyethoxy)-5-methoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 90269328 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(2-hydroxyethoxy)-5-methoxyanthracene-9,10-dione |
| SMILES | COc1cccc2c1C(=O)c1cccc(OCCO)c1C2=O |
| InChI | InChI=1S/C17H14O5/c1-21-12-6-2-4-10-14(12)16(19)11-5-3-7-13(22-9-8-18)15(11)17(10)20/h2-7,18H,8-9H2,1H3 |
| InChIKey | LQGUWXSDSSBTAL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|