C15H12O7 — CID 10470278
dimethyl 5-methoxy-1,4-dioxonaphthalene-2,3-dicarboxylate (PubChem CID 10470278) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is dimethyl 5-methoxy-1,4-dioxonaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 5-methoxy-1,4-dioxonaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10470278 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | dimethyl 5-methoxy-1,4-dioxonaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(=O)c2c(OC)cccc2C1=O |
| InChI | InChI=1S/C15H12O7/c1-20-8-6-4-5-7-9(8)13(17)11(15(19)22-3)10(12(7)16)14(18)21-2/h4-6H,1-3H3 |
| InChIKey | VRKUAASBBGVUBC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|