C18H14O6 — CID 134937894
ethyl 1-hydroxy-5-methoxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 134937894) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is ethyl 1-hydroxy-5-methoxy-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | ethyl 1-hydroxy-5-methoxy-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 134937894 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | ethyl 1-hydroxy-5-methoxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1O)C(=O)c1cccc(OC)c1C2=O |
| InChI | InChI=1S/C18H14O6/c1-3-24-18(22)11-8-7-10-14(17(11)21)16(20)9-5-4-6-12(23-2)13(9)15(10)19/h4-8,21H,3H2,1-2H3 |
| InChIKey | SFJOSEQINVBXLC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|