C17H14O5 — CID 11300971
1-hydroxy-2-(1-hydroxyethyl)-8-methoxyanthracene-9,10-dione (PubChem CID 11300971) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-hydroxy-2-(1-hydroxyethyl)-8-methoxyanthracene-9,10-dione.
| Compound Name | 1-hydroxy-2-(1-hydroxyethyl)-8-methoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 11300971 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-hydroxy-2-(1-hydroxyethyl)-8-methoxyanthracene-9,10-dione |
| SMILES | COc1cccc2c1C(=O)c1c(ccc(C(C)O)c1O)C2=O |
| InChI | InChI=1S/C17H14O5/c1-8(18)9-6-7-11-14(16(9)20)17(21)13-10(15(11)19)4-3-5-12(13)22-2/h3-8,18,20H,1-2H3 |
| InChIKey | RKCMNPMZKCWSGW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|