C15H12O3 — CID 19594782
1,5-dimethoxyfluoren-9-one (PubChem CID 19594782) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1,5-dimethoxyfluoren-9-one.
| Compound Name | 1,5-dimethoxyfluoren-9-one |
|---|---|
| PubChem CID | 19594782 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1,5-dimethoxyfluoren-9-one |
| SMILES | COc1cccc2c1C(=O)c1cccc(OC)c1-2 |
| InChI | InChI=1S/C15H12O3/c1-17-11-7-4-6-10-13(11)9-5-3-8-12(18-2)14(9)15(10)16/h3-8H,1-2H3 |
| InChIKey | IEKPQVONJORASS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |