C18H14O4 — CID 100970619
1-methoxy-5-prop-2-enoxyanthracene-9,10-dione (PubChem CID 100970619) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-methoxy-5-prop-2-enoxyanthracene-9,10-dione.
| Compound Name | 1-methoxy-5-prop-2-enoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 100970619 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-methoxy-5-prop-2-enoxyanthracene-9,10-dione |
| SMILES | C=CCOc1cccc2c1C(=O)c1cccc(OC)c1C2=O |
| InChI | InChI=1S/C18H14O4/c1-3-10-22-14-9-5-7-12-16(14)18(20)11-6-4-8-13(21-2)15(11)17(12)19/h3-9H,1,10H2,2H3 |
| InChIKey | BZLNYPSOQQSVAQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|