C23H21NO5 — CID 122195411
3-[(E)-ethoxyiminomethyl]-1,8-bis(prop-2-enoxy)anthracene-9,10-dione (PubChem CID 122195411) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-[(E)-ethoxyiminomethyl]-1,8-bis(prop-2-enoxy)anthracene-9,10-dione.
| Compound Name | 3-[(E)-ethoxyiminomethyl]-1,8-bis(prop-2-enoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 122195411 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-[(E)-ethoxyiminomethyl]-1,8-bis(prop-2-enoxy)anthracene-9,10-dione |
| SMILES | C=CCOc1cccc2c1C(=O)c1c(OCC=C)cc(/C=N/OCC)cc1C2=O |
| InChI | InChI=1S/C23H21NO5/c1-4-10-27-18-9-7-8-16-20(18)23(26)21-17(22(16)25)12-15(14-24-29-6-3)13-19(21)28-11-5-2/h4-5,7-9,12-14H,1-2,6,10-11H2,3H3/b24-14+ |
| InChIKey | QSKSYCDLFCFXRS-ZVHZXABRSA-N |
| XLogP | 3.96 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|