C22H22ClNO5 — CID 72944246
2-chloro-N-(9,10-dioxo-4,5-dipropoxyanthracen-2-yl)acetamide (PubChem CID 72944246) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is 2-chloro-N-(9,10-dioxo-4,5-dipropoxyanthracen-2-yl)acetamide.
| Compound Name | 2-chloro-N-(9,10-dioxo-4,5-dipropoxyanthracen-2-yl)acetamide |
|---|---|
| PubChem CID | 72944246 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-chloro-N-(9,10-dioxo-4,5-dipropoxyanthracen-2-yl)acetamide |
| SMILES | CCCOc1cccc2c1C(=O)c1c(OCCC)cc(NC(=O)CCl)cc1C2=O |
| InChI | InChI=1S/C22H22ClNO5/c1-3-8-28-16-7-5-6-14-19(16)22(27)20-15(21(14)26)10-13(24-18(25)12-23)11-17(20)29-9-4-2/h5-7,10-11H,3-4,8-9,12H2,1-2H3,(H,24,25) |
| InChIKey | GZUAONCDQFICIN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|