C20H18ClNO5 — CID 72944134
4-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)butanamide (PubChem CID 72944134) has the molecular formula C20H18ClNO5 and a molecular weight of 387.82 g/mol. Its IUPAC name is 4-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)butanamide.
| Compound Name | 4-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)butanamide |
|---|---|
| PubChem CID | 72944134 |
| Molecular Formula | C20H18ClNO5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)butanamide |
| SMILES | COc1cccc2c1C(=O)c1c(OC)cc(NC(=O)CCCCl)cc1C2=O |
| InChI | InChI=1S/C20H18ClNO5/c1-26-14-6-3-5-12-17(14)20(25)18-13(19(12)24)9-11(10-15(18)27-2)22-16(23)7-4-8-21/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,22,23) |
| InChIKey | WNUBXNLOIXBSJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|