C19H14ClNO5 — CID 146171498
2-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)prop-2-enamide (PubChem CID 146171498) has the molecular formula C19H14ClNO5 and a molecular weight of 371.78 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)prop-2-enamide.
| Compound Name | 2-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146171498 |
| Molecular Formula | C19H14ClNO5 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-chloro-N-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)Nc1cc(OC)c2c(c1)C(=O)c1cccc(OC)c1C2=O |
| InChI | InChI=1S/C19H14ClNO5/c1-9(20)19(24)21-10-7-12-16(14(8-10)26-3)18(23)15-11(17(12)22)5-4-6-13(15)25-2/h4-8H,1H2,2-3H3,(H,21,24) |
| InChIKey | NWZBAUIMMUSKMS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|