C24H26ClNO7 — CID 155514530
N-[4,5-bis(3-methoxypropoxy)-9,10-dioxoanthracen-2-yl]-2-chloroacetamide (PubChem CID 155514530) has the molecular formula C24H26ClNO7 and a molecular weight of 475.93 g/mol. Its IUPAC name is N-[4,5-bis(3-methoxypropoxy)-9,10-dioxoanthracen-2-yl]-2-chloroacetamide.
| Compound Name | N-[4,5-bis(3-methoxypropoxy)-9,10-dioxoanthracen-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 155514530 |
| Molecular Formula | C24H26ClNO7 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[4,5-bis(3-methoxypropoxy)-9,10-dioxoanthracen-2-yl]-2-chloroacetamide |
| SMILES | COCCCOc1cccc2c1C(=O)c1c(OCCCOC)cc(NC(=O)CCl)cc1C2=O |
| InChI | InChI=1S/C24H26ClNO7/c1-30-8-4-10-32-18-7-3-6-16-21(18)24(29)22-17(23(16)28)12-15(26-20(27)14-25)13-19(22)33-11-5-9-31-2/h3,6-7,12-13H,4-5,8-11,14H2,1-2H3,(H,26,27) |
| InChIKey | JLBJGHJZRAWAQF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|