C21H22O6 — CID 14472276
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anthracene-9,10-dione (PubChem CID 14472276) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anthracene-9,10-dione.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anthracene-9,10-dione |
|---|---|
| PubChem CID | 14472276 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anthracene-9,10-dione |
| SMILES | COCCOCCOCCOc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H22O6/c1-24-9-10-25-11-12-26-13-14-27-18-8-4-7-17-19(18)21(23)16-6-3-2-5-15(16)20(17)22/h2-8H,9-14H2,1H3 |
| InChIKey | YUKXPXFKQQHFCA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|