C17H11NO3 — CID 160717231
3-(9,10-dioxoanthracen-1-yl)oxypropanenitrile (PubChem CID 160717231) has the molecular formula C17H11NO3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-(9,10-dioxoanthracen-1-yl)oxypropanenitrile.
| Compound Name | 3-(9,10-dioxoanthracen-1-yl)oxypropanenitrile |
|---|---|
| PubChem CID | 160717231 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-(9,10-dioxoanthracen-1-yl)oxypropanenitrile |
| SMILES | N#CCCOc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11NO3/c18-9-4-10-21-14-8-3-7-13-15(14)17(20)12-6-2-1-5-11(12)16(13)19/h1-3,5-8H,4,10H2 |
| InChIKey | RSQCBAPUDHODMQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|