C16H12O6S — CID 142419416
2-(9,10-dioxoanthracen-1-yl)oxyethanesulfonic acid (PubChem CID 142419416) has the molecular formula C16H12O6S and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-(9,10-dioxoanthracen-1-yl)oxyethanesulfonic acid.
| Compound Name | 2-(9,10-dioxoanthracen-1-yl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 142419416 |
| Molecular Formula | C16H12O6S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-(9,10-dioxoanthracen-1-yl)oxyethanesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)c2c(OCCS(=O)(=O)O)cccc21 |
| InChI | InChI=1S/C16H12O6S/c17-15-10-4-1-2-5-11(10)16(18)14-12(15)6-3-7-13(14)22-8-9-23(19,20)21/h1-7H,8-9H2,(H,19,20,21) |
| InChIKey | BNWPIYFIKHAGFD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|