C18H16O10S2 — CID 142419389
2-[9,10-dioxo-6-(2-sulfoethoxy)anthracen-2-yl]oxyethanesulfonic acid (PubChem CID 142419389) has the molecular formula C18H16O10S2 and a molecular weight of 456.45 g/mol. Its IUPAC name is 2-[9,10-dioxo-6-(2-sulfoethoxy)anthracen-2-yl]oxyethanesulfonic acid.
| Compound Name | 2-[9,10-dioxo-6-(2-sulfoethoxy)anthracen-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 142419389 |
| Molecular Formula | C18H16O10S2 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-[9,10-dioxo-6-(2-sulfoethoxy)anthracen-2-yl]oxyethanesulfonic acid |
| SMILES | O=C1c2ccc(OCCS(=O)(=O)O)cc2C(=O)c2ccc(OCCS(=O)(=O)O)cc21 |
| InChI | InChI=1S/C18H16O10S2/c19-17-13-3-1-11(27-5-7-29(21,22)23)9-15(13)18(20)14-4-2-12(10-16(14)17)28-6-8-30(24,25)26/h1-4,9-10H,5-8H2,(H,21,22,23)(H,24,25,26) |
| InChIKey | NJKSLBBBDYSRRH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|