C25H30Cl2O7 — CID 6420971
2,7-bis[2-[2-(2-chloroethoxy)ethoxy]ethoxy]fluoren-9-one (PubChem CID 6420971) has the molecular formula C25H30Cl2O7 and a molecular weight of 513.41 g/mol. Its IUPAC name is 2,7-bis[2-[2-(2-chloroethoxy)ethoxy]ethoxy]fluoren-9-one.
| Compound Name | 2,7-bis[2-[2-(2-chloroethoxy)ethoxy]ethoxy]fluoren-9-one |
|---|---|
| PubChem CID | 6420971 |
| Molecular Formula | C25H30Cl2O7 |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2,7-bis[2-[2-(2-chloroethoxy)ethoxy]ethoxy]fluoren-9-one |
| SMILES | O=C1c2cc(OCCOCCOCCCl)ccc2-c2ccc(OCCOCCOCCCl)cc21 |
| InChI | InChI=1S/C25H30Cl2O7/c26-5-7-29-9-11-31-13-15-33-19-1-3-21-22-4-2-20(18-24(22)25(28)23(21)17-19)34-16-14-32-12-10-30-8-6-27/h1-4,17-18H,5-16H2 |
| InChIKey | XUECJUMFSQEXMQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|