C26H38Cl2O8 — CID 10554662
2,6-bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]naphthalene (PubChem CID 10554662) has the molecular formula C26H38Cl2O8 and a molecular weight of 549.49 g/mol. Its IUPAC name is 2,6-bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]naphthalene.
| Compound Name | 2,6-bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]naphthalene |
|---|---|
| PubChem CID | 10554662 |
| Molecular Formula | C26H38Cl2O8 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 2,6-bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]naphthalene |
| SMILES | ClCCOCCOCCOCCOc1ccc2cc(OCCOCCOCCOCCCl)ccc2c1 |
| InChI | InChI=1S/C26H38Cl2O8/c27-5-7-29-9-11-31-13-15-33-17-19-35-25-3-1-23-21-26(4-2-24(23)22-25)36-20-18-34-16-14-32-12-10-30-8-6-28/h1-4,21-22H,5-20H2 |
| InChIKey | SVWSWANSXJGVBS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|