C25H36N2O3+2 — CID 57439338
trimethyl-[3-[9-oxo-6-[3-(trimethylazaniumyl)propoxy]fluoren-2-yl]oxypropyl]azanium (PubChem CID 57439338) has the molecular formula C25H36N2O3+2 and a molecular weight of 412.57 g/mol. Its IUPAC name is trimethyl-[3-[9-oxo-6-[3-(trimethylazaniumyl)propoxy]fluoren-2-yl]oxypropyl]azanium.
| Compound Name | trimethyl-[3-[9-oxo-6-[3-(trimethylazaniumyl)propoxy]fluoren-2-yl]oxypropyl]azanium |
|---|---|
| PubChem CID | 57439338 |
| Molecular Formula | C25H36N2O3+2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | trimethyl-[3-[9-oxo-6-[3-(trimethylazaniumyl)propoxy]fluoren-2-yl]oxypropyl]azanium |
| SMILES | C[N+](C)(C)CCCOc1ccc2c(c1)C(=O)c1ccc(OCCC[N+](C)(C)C)cc1-2 |
| InChI | InChI=1S/C25H36N2O3/c1-26(2,3)13-7-15-29-19-10-12-22-23(17-19)21-11-9-20(18-24(21)25(22)28)30-16-8-14-27(4,5)6/h9-12,17-18H,7-8,13-16H2,1-6H3/q+2 |
| InChIKey | NHJRFKRHUBTGOH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|