C25H38N3O3+ — CID 87438490
trimethyl-[3-[[5-oxido-3-[3-(trimethylazaniumyl)propoxy]-6H-phenanthridin-8-yl]oxy]propyl]azanium (PubChem CID 87438490) has the molecular formula C25H38N3O3+ and a molecular weight of 428.60 g/mol. Its IUPAC name is trimethyl-[3-[[5-oxido-3-[3-(trimethylazaniumyl)propoxy]-6H-phenanthridin-8-yl]oxy]propyl]azanium.
| Compound Name | trimethyl-[3-[[5-oxido-3-[3-(trimethylazaniumyl)propoxy]-6H-phenanthridin-8-yl]oxy]propyl]azanium |
|---|---|
| PubChem CID | 87438490 |
| Molecular Formula | C25H38N3O3+ |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | trimethyl-[3-[[5-oxido-3-[3-(trimethylazaniumyl)propoxy]-6H-phenanthridin-8-yl]oxy]propyl]azanium |
| SMILES | C[N+](C)(C)CCCOc1ccc2c(c1)CN([O-])c1cc(OCCC[N+](C)(C)C)ccc1-2 |
| InChI | InChI=1S/C25H38N3O3/c1-27(2,3)13-7-15-30-21-9-11-23-20(17-21)19-26(29)25-18-22(10-12-24(23)25)31-16-8-14-28(4,5)6/h9-12,17-18H,7-8,13-16,19H2,1-6H3/q+1 |
| InChIKey | BUHQCUZENYGJAJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|