C23H34N2O2+2 — CID 11545195
trimethyl-[2-[[7-[2-(trimethylazaniumyl)ethoxy]-9H-fluoren-2-yl]oxy]ethyl]azanium (PubChem CID 11545195) has the molecular formula C23H34N2O2+2 and a molecular weight of 370.54 g/mol. Its IUPAC name is trimethyl-[2-[[7-[2-(trimethylazaniumyl)ethoxy]-9H-fluoren-2-yl]oxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[[7-[2-(trimethylazaniumyl)ethoxy]-9H-fluoren-2-yl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 11545195 |
| Molecular Formula | C23H34N2O2+2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | trimethyl-[2-[[7-[2-(trimethylazaniumyl)ethoxy]-9H-fluoren-2-yl]oxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOc1ccc2c(c1)Cc1cc(OCC[N+](C)(C)C)ccc1-2 |
| InChI | InChI=1S/C23H34N2O2/c1-24(2,3)11-13-26-20-7-9-22-18(16-20)15-19-17-21(8-10-23(19)22)27-14-12-25(4,5)6/h7-10,16-17H,11-15H2,1-6H3/q+2 |
| InChIKey | QLLLDOCALODQLR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|