C27H40N2O2 — CID 57439221
3-[[6-[3-(diethylamino)propoxy]-9H-fluoren-2-yl]oxy]-N,N-diethylpropan-1-amine (PubChem CID 57439221) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 3-[[6-[3-(diethylamino)propoxy]-9H-fluoren-2-yl]oxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[[6-[3-(diethylamino)propoxy]-9H-fluoren-2-yl]oxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 57439221 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | 3-[[6-[3-(diethylamino)propoxy]-9H-fluoren-2-yl]oxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc2c(c1)Cc1ccc(OCCCN(CC)CC)cc1-2 |
| InChI | InChI=1S/C27H40N2O2/c1-5-28(6-2)15-9-17-30-24-13-14-26-23(20-24)19-22-11-12-25(21-27(22)26)31-18-10-16-29(7-3)8-4/h11-14,20-21H,5-10,15-19H2,1-4H3 |
| InChIKey | AMVIOASVUUPGJY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|