C26H38N2O4S — CID 67163167
3-[8-[3-(diethylamino)propoxy]-5,5-dioxodibenzothiophen-2-yl]oxy-N,N-diethylpropan-1-amine (PubChem CID 67163167) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is 3-[8-[3-(diethylamino)propoxy]-5,5-dioxodibenzothiophen-2-yl]oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-[8-[3-(diethylamino)propoxy]-5,5-dioxodibenzothiophen-2-yl]oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 67163167 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 3-[8-[3-(diethylamino)propoxy]-5,5-dioxodibenzothiophen-2-yl]oxy-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc2c(c1)-c1cc(OCCCN(CC)CC)ccc1S2(=O)=O |
| InChI | InChI=1S/C26H38N2O4S/c1-5-27(6-2)15-9-17-31-21-11-13-25-23(19-21)24-20-22(12-14-26(24)33(25,29)30)32-18-10-16-28(7-3)8-4/h11-14,19-20H,5-10,15-18H2,1-4H3 |
| InChIKey | SHQHCFXVGXVZDR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|