C16H18N2O4S — CID 67164166
2-[8-(2-aminoethoxy)-5,5-dioxodibenzothiophen-2-yl]oxyethanamine (PubChem CID 67164166) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[8-(2-aminoethoxy)-5,5-dioxodibenzothiophen-2-yl]oxyethanamine.
| Compound Name | 2-[8-(2-aminoethoxy)-5,5-dioxodibenzothiophen-2-yl]oxyethanamine |
|---|---|
| PubChem CID | 67164166 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[8-(2-aminoethoxy)-5,5-dioxodibenzothiophen-2-yl]oxyethanamine |
| SMILES | NCCOc1ccc2c(c1)-c1cc(OCCN)ccc1S2(=O)=O |
| InChI | InChI=1S/C16H18N2O4S/c17-5-7-21-11-1-3-15-13(9-11)14-10-12(22-8-6-18)2-4-16(14)23(15,19)20/h1-4,9-10H,5-8,17-18H2 |
| InChIKey | NSYMGHYNFWAPAO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |