C22H30N2O4S — CID 67164379
N-[2-[5,5-dioxo-7-[2-(propylamino)ethoxy]dibenzothiophen-2-yl]oxyethyl]propan-1-amine (PubChem CID 67164379) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[2-[5,5-dioxo-7-[2-(propylamino)ethoxy]dibenzothiophen-2-yl]oxyethyl]propan-1-amine.
| Compound Name | N-[2-[5,5-dioxo-7-[2-(propylamino)ethoxy]dibenzothiophen-2-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 67164379 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-[5,5-dioxo-7-[2-(propylamino)ethoxy]dibenzothiophen-2-yl]oxyethyl]propan-1-amine |
| SMILES | CCCNCCOc1ccc2c(c1)-c1ccc(OCCNCCC)cc1S2(=O)=O |
| InChI | InChI=1S/C22H30N2O4S/c1-3-9-23-11-13-27-17-6-8-21-20(15-17)19-7-5-18(16-22(19)29(21,25)26)28-14-12-24-10-4-2/h5-8,15-16,23-24H,3-4,9-14H2,1-2H3 |
| InChIKey | HVYIPEHXIXYIGV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|