C23H30N2O4 — CID 57439577
3,6-bis[2-(propylamino)ethoxy]xanthen-9-one (PubChem CID 57439577) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3,6-bis[2-(propylamino)ethoxy]xanthen-9-one.
| Compound Name | 3,6-bis[2-(propylamino)ethoxy]xanthen-9-one |
|---|---|
| PubChem CID | 57439577 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3,6-bis[2-(propylamino)ethoxy]xanthen-9-one |
| SMILES | CCCNCCOc1ccc2c(=O)c3ccc(OCCNCCC)cc3oc2c1 |
| InChI | InChI=1S/C23H30N2O4/c1-3-9-24-11-13-27-17-5-7-19-21(15-17)29-22-16-18(6-8-20(22)23(19)26)28-14-12-25-10-4-2/h5-8,15-16,24-25H,3-4,9-14H2,1-2H3 |
| InChIKey | KKQCUPDTVBOBLZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|