C26H37N3O3 — CID 57439740
10-methyl-3,6-bis[3-(propylamino)propoxy]acridin-9-one (PubChem CID 57439740) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 10-methyl-3,6-bis[3-(propylamino)propoxy]acridin-9-one.
| Compound Name | 10-methyl-3,6-bis[3-(propylamino)propoxy]acridin-9-one |
|---|---|
| PubChem CID | 57439740 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 10-methyl-3,6-bis[3-(propylamino)propoxy]acridin-9-one |
| SMILES | CCCNCCCOc1ccc2c(=O)c3ccc(OCCCNCCC)cc3n(C)c2c1 |
| InChI | InChI=1S/C26H37N3O3/c1-4-12-27-14-6-16-31-20-8-10-22-24(18-20)29(3)25-19-21(9-11-23(25)26(22)30)32-17-7-15-28-13-5-2/h8-11,18-19,27-28H,4-7,12-17H2,1-3H3 |
| InChIKey | WNYHMWJYOPFLAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|