C23H31N3O3 — CID 57439648
2,7-bis[2-(propylamino)ethoxy]-10H-acridin-9-one (PubChem CID 57439648) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2,7-bis[2-(propylamino)ethoxy]-10H-acridin-9-one.
| Compound Name | 2,7-bis[2-(propylamino)ethoxy]-10H-acridin-9-one |
|---|---|
| PubChem CID | 57439648 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2,7-bis[2-(propylamino)ethoxy]-10H-acridin-9-one |
| SMILES | CCCNCCOc1ccc2[nH]c3ccc(OCCNCCC)cc3c(=O)c2c1 |
| InChI | InChI=1S/C23H31N3O3/c1-3-9-24-11-13-28-17-5-7-21-19(15-17)23(27)20-16-18(6-8-22(20)26-21)29-14-12-25-10-4-2/h5-8,15-16,24-25H,3-4,9-14H2,1-2H3,(H,26,27) |
| InChIKey | OZTYYDNZTLLBGK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|