C17H17NO3 — CID 163923657
2,7-diethoxy-10H-acridin-9-one (PubChem CID 163923657) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,7-diethoxy-10H-acridin-9-one.
| Compound Name | 2,7-diethoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 163923657 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2,7-diethoxy-10H-acridin-9-one |
| SMILES | CCOc1ccc2[nH]c3ccc(OCC)cc3c(=O)c2c1 |
| InChI | InChI=1S/C17H17NO3/c1-3-20-11-5-7-15-13(9-11)17(19)14-10-12(21-4-2)6-8-16(14)18-15/h5-10H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | RCOXOLARXNQWIO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|