C13H13NO2 — CID 107958537
7-ethoxy-3,4-dihydro-2H-cyclopenta[b]indol-1-one (PubChem CID 107958537) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 7-ethoxy-3,4-dihydro-2H-cyclopenta[b]indol-1-one.
| Compound Name | 7-ethoxy-3,4-dihydro-2H-cyclopenta[b]indol-1-one |
|---|---|
| PubChem CID | 107958537 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 7-ethoxy-3,4-dihydro-2H-cyclopenta[b]indol-1-one |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)C(=O)CC3 |
| InChI | InChI=1S/C13H13NO2/c1-2-16-8-3-4-10-9(7-8)13-11(14-10)5-6-12(13)15/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | GHKDEGPCJWZCEX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |