C15H19NO — CID 107958588
2-ethoxy-5,6,7,8,9,10-hexahydrocyclohepta[b]indole (PubChem CID 107958588) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-ethoxy-5,6,7,8,9,10-hexahydrocyclohepta[b]indole.
| Compound Name | 2-ethoxy-5,6,7,8,9,10-hexahydrocyclohepta[b]indole |
|---|---|
| PubChem CID | 107958588 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-ethoxy-5,6,7,8,9,10-hexahydrocyclohepta[b]indole |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)CCCCC3 |
| InChI | InChI=1S/C15H19NO/c1-2-17-11-8-9-15-13(10-11)12-6-4-3-5-7-14(12)16-15/h8-10,16H,2-7H2,1H3 |
| InChIKey | XZQSINQKLNTXHV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|