C24H24F3NO2 — CID 141379893
7-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 141379893) has the molecular formula C24H24F3NO2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 7-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 7-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 141379893 |
| Molecular Formula | C24H24F3NO2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 7-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | FC(F)(F)c1cc(COc2ccc3[nH]c4c(c3c2)CCC4)ccc1OC1CCCC1 |
| InChI | InChI=1S/C24H24F3NO2/c25-24(26,27)20-12-15(8-11-23(20)30-16-4-1-2-5-16)14-29-17-9-10-22-19(13-17)18-6-3-7-21(18)28-22/h8-13,16,28H,1-7,14H2 |
| InChIKey | BQUGNONZAWZPOG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|