C26H28F3NO2 — CID 170051485
4-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-3-methyl-1H-indol-2-yl]butan-2-one (PubChem CID 170051485) has the molecular formula C26H28F3NO2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-3-methyl-1H-indol-2-yl]butan-2-one.
| Compound Name | 4-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-3-methyl-1H-indol-2-yl]butan-2-one |
|---|---|
| PubChem CID | 170051485 |
| Molecular Formula | C26H28F3NO2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-3-methyl-1H-indol-2-yl]butan-2-one |
| SMILES | CC(=O)CCc1[nH]c2ccc(OCc3ccc(C4CCCC4)c(C(F)(F)F)c3)cc2c1C |
| InChI | InChI=1S/C26H28F3NO2/c1-16(31)7-11-24-17(2)22-14-20(9-12-25(22)30-24)32-15-18-8-10-21(19-5-3-4-6-19)23(13-18)26(27,28)29/h8-10,12-14,19,30H,3-7,11,15H2,1-2H3 |
| InChIKey | SYPCKFUTFAKNBC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|