C25H26F3NO3 — CID 146661528
3-[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoic acid (PubChem CID 146661528) has the molecular formula C25H26F3NO3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 3-[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoic acid.
| Compound Name | 3-[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 146661528 |
| Molecular Formula | C25H26F3NO3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 3-[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1cc2cc(OCc3ccc(C4CCCCC4)c(C(F)(F)F)c3)ccc2[nH]1 |
| InChI | InChI=1S/C25H26F3NO3/c26-25(27,28)22-12-16(6-9-21(22)17-4-2-1-3-5-17)15-32-20-8-10-23-18(14-20)13-19(29-23)7-11-24(30)31/h6,8-10,12-14,17,29H,1-5,7,11,15H2,(H,30,31) |
| InChIKey | PLCWOXJBEXTKDI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |