C25H26F3NO3 — CID 170313430
2-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]ethyl acetate (PubChem CID 170313430) has the molecular formula C25H26F3NO3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]ethyl acetate.
| Compound Name | 2-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 170313430 |
| Molecular Formula | C25H26F3NO3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1ccc2cc(OCc3ccc(C4CCCC4)c(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C25H26F3NO3/c1-17(30)31-13-12-29-11-10-20-15-21(7-9-24(20)29)32-16-18-6-8-22(19-4-2-3-5-19)23(14-18)25(26,27)28/h6-11,14-15,19H,2-5,12-13,16H2,1H3 |
| InChIKey | JZCXHXDBSAWJMV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |