C23H27F3O2 — CID 146669389
[4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-propan-2-ylphenyl]methanol (PubChem CID 146669389) has the molecular formula C23H27F3O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is [4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-propan-2-ylphenyl]methanol.
| Compound Name | [4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-propan-2-ylphenyl]methanol |
|---|---|
| PubChem CID | 146669389 |
| Molecular Formula | C23H27F3O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-propan-2-ylphenyl]methanol |
| SMILES | CC(C)c1cc(OCc2ccc(C3CCCC3)c(C(F)(F)F)c2)ccc1CO |
| InChI | InChI=1S/C23H27F3O2/c1-15(2)21-12-19(9-8-18(21)13-27)28-14-16-7-10-20(17-5-3-4-6-17)22(11-16)23(24,25)26/h7-12,15,17,27H,3-6,13-14H2,1-2H3 |
| InChIKey | HXJVXYFYOMVEDR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |