C26H28F3NO3 — CID 162427543
3-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-7-ethylindol-1-yl]propanoic acid (PubChem CID 162427543) has the molecular formula C26H28F3NO3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 3-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-7-ethylindol-1-yl]propanoic acid.
| Compound Name | 3-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-7-ethylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 162427543 |
| Molecular Formula | C26H28F3NO3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-7-ethylindol-1-yl]propanoic acid |
| SMILES | CCc1cc(OCc2ccc(C3CCCC3)c(C(F)(F)F)c2)cc2ccn(CCC(=O)O)c12 |
| InChI | InChI=1S/C26H28F3NO3/c1-2-18-14-21(15-20-9-11-30(25(18)20)12-10-24(31)32)33-16-17-7-8-22(19-5-3-4-6-19)23(13-17)26(27,28)29/h7-9,11,13-15,19H,2-6,10,12,16H2,1H3,(H,31,32) |
| InChIKey | CXCBVDOLVQEQAU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |