C25H27ClF3NO4S — CID 162427538
3-[7-chloro-5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]propyl methanesulfonate (PubChem CID 162427538) has the molecular formula C25H27ClF3NO4S and a molecular weight of 530.01 g/mol. Its IUPAC name is 3-[7-chloro-5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]propyl methanesulfonate.
| Compound Name | 3-[7-chloro-5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 162427538 |
| Molecular Formula | C25H27ClF3NO4S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-[7-chloro-5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]indol-1-yl]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCn1ccc2cc(OCc3ccc(C4CCCC4)c(C(F)(F)F)c3)cc(Cl)c21 |
| InChI | InChI=1S/C25H27ClF3NO4S/c1-35(31,32)34-12-4-10-30-11-9-19-14-20(15-23(26)24(19)30)33-16-17-7-8-21(18-5-2-3-6-18)22(13-17)25(27,28)29/h7-9,11,13-15,18H,2-6,10,12,16H2,1H3 |
| InChIKey | FPIXJVGZNYUCCU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|