C20H21F3N2O3 — CID 166786757
4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-N-methyl-2-nitroaniline (PubChem CID 166786757) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is 4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-N-methyl-2-nitroaniline.
| Compound Name | 4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-N-methyl-2-nitroaniline |
|---|---|
| PubChem CID | 166786757 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-N-methyl-2-nitroaniline |
| SMILES | CNc1ccc(OCc2ccc(C3CCCC3)c(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21F3N2O3/c1-24-18-9-7-15(11-19(18)25(26)27)28-12-13-6-8-16(14-4-2-3-5-14)17(10-13)20(21,22)23/h6-11,14,24H,2-5,12H2,1H3 |
| InChIKey | MBJSUHVTKQUXCY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|