C27H30F3NO5 — CID 145219049
6-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-(methylamino)phenyl]-3-formyl-6-oxohexanoic acid (PubChem CID 145219049) has the molecular formula C27H30F3NO5 and a molecular weight of 505.53 g/mol. Its IUPAC name is 6-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-(methylamino)phenyl]-3-formyl-6-oxohexanoic acid.
| Compound Name | 6-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-(methylamino)phenyl]-3-formyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 145219049 |
| Molecular Formula | C27H30F3NO5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 6-[5-[[4-cyclopentyl-3-(trifluoromethyl)phenyl]methoxy]-2-(methylamino)phenyl]-3-formyl-6-oxohexanoic acid |
| SMILES | CNc1ccc(OCc2ccc(C3CCCC3)c(C(F)(F)F)c2)cc1C(=O)CCC(C=O)CC(=O)O |
| InChI | InChI=1S/C27H30F3NO5/c1-31-24-10-8-20(14-22(24)25(33)11-7-17(15-32)13-26(34)35)36-16-18-6-9-21(19-4-2-3-5-19)23(12-18)27(28,29)30/h6,8-10,12,14-15,17,19,31H,2-5,7,11,13,16H2,1H3,(H,34,35) |
| InChIKey | KZMNBWVNCYNEOO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|