C25H26F3NO4 — CID 146661135
ethyl 3-[5-[[4-(oxolan-3-yl)-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoate (PubChem CID 146661135) has the molecular formula C25H26F3NO4 and a molecular weight of 461.48 g/mol. Its IUPAC name is ethyl 3-[5-[[4-(oxolan-3-yl)-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoate.
| Compound Name | ethyl 3-[5-[[4-(oxolan-3-yl)-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoate |
|---|---|
| PubChem CID | 146661135 |
| Molecular Formula | C25H26F3NO4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | ethyl 3-[5-[[4-(oxolan-3-yl)-3-(trifluoromethyl)phenyl]methoxy]-1H-indol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1cc2cc(OCc3ccc(C4CCOC4)c(C(F)(F)F)c3)ccc2[nH]1 |
| InChI | InChI=1S/C25H26F3NO4/c1-2-32-24(30)8-4-19-12-18-13-20(5-7-23(18)29-19)33-14-16-3-6-21(17-9-10-31-15-17)22(11-16)25(26,27)28/h3,5-7,11-13,17,29H,2,4,8-10,14-15H2,1H3 |
| InChIKey | WBTPTJROUBRVFD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |