C24H26ClNO4 — CID 163795173
methyl 3-[3-chloro-5-[[3-methyl-4-(oxolan-3-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate (PubChem CID 163795173) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is methyl 3-[3-chloro-5-[[3-methyl-4-(oxolan-3-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate.
| Compound Name | methyl 3-[3-chloro-5-[[3-methyl-4-(oxolan-3-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate |
|---|---|
| PubChem CID | 163795173 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | methyl 3-[3-chloro-5-[[3-methyl-4-(oxolan-3-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate |
| SMILES | COC(=O)CCc1[nH]c2ccc(OCc3ccc(C4CCOC4)c(C)c3)cc2c1Cl |
| InChI | InChI=1S/C24H26ClNO4/c1-15-11-16(3-5-19(15)17-9-10-29-14-17)13-30-18-4-6-21-20(12-18)24(25)22(26-21)7-8-23(27)28-2/h3-6,11-12,17,26H,7-10,13-14H2,1-2H3 |
| InChIKey | OZBNQMFDTOZIRR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |