C26H25ClF3NO2 — CID 146663488
3-chloro-5-[[4-(cyclopenten-1-yl)-3-(trifluoromethyl)phenyl]methoxy]-2-(3-methoxybut-3-enyl)-1H-indole (PubChem CID 146663488) has the molecular formula C26H25ClF3NO2 and a molecular weight of 475.94 g/mol. Its IUPAC name is 3-chloro-5-[[4-(cyclopenten-1-yl)-3-(trifluoromethyl)phenyl]methoxy]-2-(3-methoxybut-3-enyl)-1H-indole.
| Compound Name | 3-chloro-5-[[4-(cyclopenten-1-yl)-3-(trifluoromethyl)phenyl]methoxy]-2-(3-methoxybut-3-enyl)-1H-indole |
|---|---|
| PubChem CID | 146663488 |
| Molecular Formula | C26H25ClF3NO2 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3-chloro-5-[[4-(cyclopenten-1-yl)-3-(trifluoromethyl)phenyl]methoxy]-2-(3-methoxybut-3-enyl)-1H-indole |
| SMILES | C=C(CCc1[nH]c2ccc(OCc3ccc(C4=CCCC4)c(C(F)(F)F)c3)cc2c1Cl)OC |
| InChI | InChI=1S/C26H25ClF3NO2/c1-16(32-2)7-11-24-25(27)21-14-19(9-12-23(21)31-24)33-15-17-8-10-20(18-5-3-4-6-18)22(13-17)26(28,29)30/h5,8-10,12-14,31H,1,3-4,6-7,11,15H2,2H3 |
| InChIKey | HCYPSMDPWOEPNM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|