C25H27F3N2O3 — CID 146661163
methyl 3-[5-[[6-cyclopentyl-5-(trifluoromethyl)-3-pyridinyl]methoxy]-3-methyl-1H-indol-2-yl]propanoate (PubChem CID 146661163) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is methyl 3-[5-[[6-cyclopentyl-5-(trifluoromethyl)-3-pyridinyl]methoxy]-3-methyl-1H-indol-2-yl]propanoate.
| Compound Name | methyl 3-[5-[[6-cyclopentyl-5-(trifluoromethyl)-3-pyridinyl]methoxy]-3-methyl-1H-indol-2-yl]propanoate |
|---|---|
| PubChem CID | 146661163 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | methyl 3-[5-[[6-cyclopentyl-5-(trifluoromethyl)-3-pyridinyl]methoxy]-3-methyl-1H-indol-2-yl]propanoate |
| SMILES | COC(=O)CCc1[nH]c2ccc(OCc3cnc(C4CCCC4)c(C(F)(F)F)c3)cc2c1C |
| InChI | InChI=1S/C25H27F3N2O3/c1-15-19-12-18(7-8-22(19)30-21(15)9-10-23(31)32-2)33-14-16-11-20(25(26,27)28)24(29-13-16)17-5-3-4-6-17/h7-8,11-13,17,30H,3-6,9-10,14H2,1-2H3 |
| InChIKey | ROMPIIOOEOHAAD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|