C26H31NO4 — CID 163740782
methyl 3-[3-methyl-5-[[3-methyl-4-(oxan-4-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate (PubChem CID 163740782) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl 3-[3-methyl-5-[[3-methyl-4-(oxan-4-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate.
| Compound Name | methyl 3-[3-methyl-5-[[3-methyl-4-(oxan-4-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate |
|---|---|
| PubChem CID | 163740782 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | methyl 3-[3-methyl-5-[[3-methyl-4-(oxan-4-yl)phenyl]methoxy]-1H-indol-2-yl]propanoate |
| SMILES | COC(=O)CCc1[nH]c2ccc(OCc3ccc(C4CCOCC4)c(C)c3)cc2c1C |
| InChI | InChI=1S/C26H31NO4/c1-17-14-19(4-6-22(17)20-10-12-30-13-11-20)16-31-21-5-7-25-23(15-21)18(2)24(27-25)8-9-26(28)29-3/h4-7,14-15,20,27H,8-13,16H2,1-3H3 |
| InChIKey | GLKFUDORELXFAO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|