C14H17NO2 — CID 116996350
methyl 3-(2,3-dimethyl-1H-indol-5-yl)propanoate (PubChem CID 116996350) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is methyl 3-(2,3-dimethyl-1H-indol-5-yl)propanoate.
| Compound Name | methyl 3-(2,3-dimethyl-1H-indol-5-yl)propanoate |
|---|---|
| PubChem CID | 116996350 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl 3-(2,3-dimethyl-1H-indol-5-yl)propanoate |
| SMILES | COC(=O)CCc1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C14H17NO2/c1-9-10(2)15-13-6-4-11(8-12(9)13)5-7-14(16)17-3/h4,6,8,15H,5,7H2,1-3H3 |
| InChIKey | GZLKNDZCWOROIS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|