C11H14N2O — CID 117281978
O-[(2,3-dimethyl-1H-indol-5-yl)methyl]hydroxylamine (PubChem CID 117281978) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is O-[(2,3-dimethyl-1H-indol-5-yl)methyl]hydroxylamine.
| Compound Name | O-[(2,3-dimethyl-1H-indol-5-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117281978 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | O-[(2,3-dimethyl-1H-indol-5-yl)methyl]hydroxylamine |
| SMILES | Cc1[nH]c2ccc(CON)cc2c1C |
| InChI | InChI=1S/C11H14N2O/c1-7-8(2)13-11-4-3-9(6-14-12)5-10(7)11/h3-5,13H,6,12H2,1-2H3 |
| InChIKey | UIOCMXHUTSVRJS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|