C11H13NV — CID 159816698
2,3,5-trimethyl-1H-indole;vanadium (PubChem CID 159816698) has the molecular formula C11H13NV and a molecular weight of 210.18 g/mol. Its IUPAC name is 2,3,5-trimethyl-1H-indole;vanadium.
| Compound Name | 2,3,5-trimethyl-1H-indole;vanadium |
|---|---|
| PubChem CID | 159816698 |
| Molecular Formula | C11H13NV |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2,3,5-trimethyl-1H-indole;vanadium |
| SMILES | Cc1ccc2[nH]c(C)c(C)c2c1.[V] |
| InChI | InChI=1S/C11H13N.V/c1-7-4-5-11-10(6-7)8(2)9(3)12-11;/h4-6,12H,1-3H3; |
| InChIKey | NLRYNZDSVUFEKU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|