C16H25N — CID 143420454
ethane;prop-1-ene;2,3,5-trimethyl-1H-indole (PubChem CID 143420454) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;prop-1-ene;2,3,5-trimethyl-1H-indole.
| Compound Name | ethane;prop-1-ene;2,3,5-trimethyl-1H-indole |
|---|---|
| PubChem CID | 143420454 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethane;prop-1-ene;2,3,5-trimethyl-1H-indole |
| SMILES | C=CC.CC.Cc1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C11H13N.C3H6.C2H6/c1-7-4-5-11-10(6-7)8(2)9(3)12-11;1-3-2;1-2/h4-6,12H,1-3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | PXXQQDMWUSYOEX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|