About 3,4,6-trimethyl-9H-carbazole
3,4,6-trimethyl-9H-carbazole (PubChem CID 610656) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,4,6-trimethyl-9H-carbazole.
Molecular Properties
| Compound Name | 3,4,6-trimethyl-9H-carbazole |
| PubChem CID | 610656 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3,4,6-trimethyl-9H-carbazole |
| SMILES | Cc1ccc2[nH]c3ccc(C)c(C)c3c2c1 |
| InChI | InChI=1S/C15H15N/c1-9-4-6-13-12(8-9)15-11(3)10(2)5-7-14(15)16-13/h4-8,16H,1-3H3 |
| InChIKey | HXLIVYICBBRXHX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,4,6-trimethyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6-trimethyl-9H-carbazole?
The IUPAC name of 3,4,6-trimethyl-9H-carbazole (CID 610656) is 3,4,6-trimethyl-9H-carbazole.
What is the SMILES notation for 3,4,6-trimethyl-9H-carbazole?
The canonical SMILES for 3,4,6-trimethyl-9H-carbazole is Cc1ccc2[nH]c3ccc(C)c(C)c3c2c1.
What is the InChIKey of 3,4,6-trimethyl-9H-carbazole?
The InChIKey is HXLIVYICBBRXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-9-4-6-13-12(8-9)15-11(3)10(2)5-7-14(15)16-13/h4-8,16H,1-3H3.
What are the key properties of 3,4,6-trimethyl-9H-carbazole?
3,4,6-trimethyl-9H-carbazole has a molecular weight of 209.29 g/mol, XLogP of 4.25, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-trimethyl-9H-carbazole is sourced from PubChem (CID 610656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).